KinG5768 KinG5768

17-12-2017
Chemistry

contestada

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(ch2)2cooh all of these compounds have the same melting point?

Respuesta :

Erudite1 Erudite1

30-12-2017

The compound with the highest melting point is CH3 [CH2]14COOH.
This compound has the highest melting point because it has the highest number of CH2 bonds. The melting point of a compound refers to a particular temperature at which that substance changes from a solid to a liquid.

Answer Link

Otras preguntas

What is the net ionic equation for this reaction? Na+(aq) + C2H3O2–(aq) + H+(aq) + Cl– (aq) → Na+(aq) + Cl– (aq) + HC2H3O2(aq)

The electricity bill of sarah's house for the last month was $60, while for this month it is $120. if p is the percent increase in the amount, which proportion

Help I don’t understand this question

A computer techician charhes $32.50 per hour plus a $75.00 service charge. Find the total charge if it takes the technician 4.5 hours to complete the task

Why does piaget use the term "concrete" to describe the quality of thinking that is characteristic of middle childhood?

When light is reflected (3 points) the direction of the light wave changes the frequency of the light wave changes the wavelength of the light wave changes

Sediment is formed by A) soil erosion. B) weathered rock. C) burial and melting. D) deposited snow and ice.

After the Civil War ended, the system of sharecropping A. offered formerly enslaved people equal opportunities to participate in the Southern economy. B. g

how do I write an equation of the line that passes through the given point and is parallel to the line (1,2); y= -5x+4

Convert to an equivalent fraction with the denominator 16 . 3/4 = /16