abiafalak8 abiafalak8

28-04-2022
Mathematics

contestada

Complete the square for: 3[tex]x^2[/tex]-18x-12

Respuesta :

antonroy72 antonroy72

30-04-2022

Answer:

[tex]3(x-3)^{2} - 15[/tex]

Answer Link

Otras preguntas

IUPAC NAME OF CH3CH2CH(CH3)CH2CH(C3H7)-CH3?

Which statement about Jim's character throughout The Adventures of Huckleberry Finn is accurate? O Jim was shown less and less as time went on. O Depictions of

Balance the following chemical equation: P4(s)+ O2(g) - P4 O10 (s)

3+7=6-|-x|Solve for x. Thanks :)

Carla is writing a formal email to her supervisor. Select the sentences that contain language inappropriate for a formal email. Dear Isak, I spent a lot of time

consider the following hypothesis test, H0, U greater than or equal to 20, Ha less than 20, a sample of 50, provided a mean of 19.4 population standard deviatio

Perform the following calculations and record your answers with the appropriate significant figures. a. 34.5 + 12.34 = ____________ b. 894 / 12 = ____________ c

valocity and acceleration of spherical coordinates and polar coordinates with complete description and derivations?

What is the measure of complemnt angle 42

Write an expression for the area of the trapezium below. Expand any brackets and fully simplify your answer.

ACCESS MORE EDU ACCESS Universidad de Mexico